C13H10ClNO2 — CID 13445605
5-chloro-9-methyl-3,4-dihydropyrano[4,3-c]quinolin-1-one (PubChem CID 13445605) has the molecular formula C13H10ClNO2 and a molecular weight of 247.68 g/mol. Its IUPAC name is 5-chloro-9-methyl-3,4-dihydropyrano[4,3-c]quinolin-1-one.
| Compound Name | 5-chloro-9-methyl-3,4-dihydropyrano[4,3-c]quinolin-1-one |
|---|---|
| PubChem CID | 13445605 |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-chloro-9-methyl-3,4-dihydropyrano[4,3-c]quinolin-1-one |
| SMILES | Cc1ccc2nc(Cl)c3c(c2c1)C(=O)OCC3 |
| InChI | InChI=1S/C13H10ClNO2/c1-7-2-3-10-9(6-7)11-8(12(14)15-10)4-5-17-13(11)16/h2-3,6H,4-5H2,1H3 |
| InChIKey | LOLCHUCWFMPAFB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|