C22H29N3O6S — CID 118334873
(2S,4S)-2-benzyl-N,N-diethyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide (PubChem CID 118334873) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is (2S,4S)-2-benzyl-N,N-diethyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide.
| Compound Name | (2S,4S)-2-benzyl-N,N-diethyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 118334873 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S,4S)-2-benzyl-N,N-diethyl-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide |
| SMILES | CCN(CC)C(=O)[C@@H](Cc1ccccc1)C[C@H](O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H29N3O6S/c1-3-24(4-2)22(27)18(14-17-8-6-5-7-9-17)15-20(26)16-23-32(30,31)21-12-10-19(11-13-21)25(28)29/h5-13,18,20,23,26H,3-4,14-16H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | ZVIKQIYCFVKPPN-ICSRJNTNSA-N |
| XLogP | 2.35 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|