C25H25F2N3O6S — CID 118334905
(2R,4S)-2-benzyl-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide (PubChem CID 118334905) has the molecular formula C25H25F2N3O6S and a molecular weight of 533.55 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 118334905 |
| Molecular Formula | C25H25F2N3O6S |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (2R,4S)-2-benzyl-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-5-[(4-nitrophenyl)sulfonylamino]pentanamide |
| SMILES | O=C(NCc1ccc(F)cc1F)[C@H](Cc1ccccc1)C[C@H](O)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H25F2N3O6S/c26-20-7-6-18(24(27)14-20)15-28-25(32)19(12-17-4-2-1-3-5-17)13-22(31)16-29-37(35,36)23-10-8-21(9-11-23)30(33)34/h1-11,14,19,22,29,31H,12-13,15-16H2,(H,28,32)/t19-,22+/m1/s1 |
| InChIKey | VVKDEXBDRYYOHW-KNQAVFIVSA-N |
| XLogP | 3.08 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|