C16H22F3N3O3 — CID 118341242
tert-butyl-[[4-[5-(trifluoromethyl)-2-pyridinyl]morpholin-2-yl]methyl]carbamic acid (PubChem CID 118341242) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is tert-butyl-[[4-[5-(trifluoromethyl)-2-pyridinyl]morpholin-2-yl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[4-[5-(trifluoromethyl)-2-pyridinyl]morpholin-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 118341242 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | tert-butyl-[[4-[5-(trifluoromethyl)-2-pyridinyl]morpholin-2-yl]methyl]carbamic acid |
| SMILES | CC(C)(C)N(CC1CN(c2ccc(C(F)(F)F)cn2)CCO1)C(=O)O |
| InChI | InChI=1S/C16H22F3N3O3/c1-15(2,3)22(14(23)24)10-12-9-21(6-7-25-12)13-5-4-11(8-20-13)16(17,18)19/h4-5,8,12H,6-7,9-10H2,1-3H3,(H,23,24) |
| InChIKey | PAXYDWFTXMDCNE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |