C22H20F2N2O4 — CID 118341673
methyl 2-[3-[N-carbamoyl-2,6-difluoro-4-(2-phenylethynyl)anilino]oxolan-3-yl]acetate (PubChem CID 118341673) has the molecular formula C22H20F2N2O4 and a molecular weight of 414.41 g/mol. Its IUPAC name is methyl 2-[3-[N-carbamoyl-2,6-difluoro-4-(2-phenylethynyl)anilino]oxolan-3-yl]acetate.
| Compound Name | methyl 2-[3-[N-carbamoyl-2,6-difluoro-4-(2-phenylethynyl)anilino]oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 118341673 |
| Molecular Formula | C22H20F2N2O4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl 2-[3-[N-carbamoyl-2,6-difluoro-4-(2-phenylethynyl)anilino]oxolan-3-yl]acetate |
| SMILES | COC(=O)CC1(N(C(N)=O)c2c(F)cc(C#Cc3ccccc3)cc2F)CCOC1 |
| InChI | InChI=1S/C22H20F2N2O4/c1-29-19(27)13-22(9-10-30-14-22)26(21(25)28)20-17(23)11-16(12-18(20)24)8-7-15-5-3-2-4-6-15/h2-6,11-12H,9-10,13-14H2,1H3,(H2,25,28) |
| InChIKey | NJOFEPBADLEBTI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|