C7H10N2O4S — CID 118343597
(2S)-2-amino-3-(2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid (PubChem CID 118343597) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 118343597 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (2S)-2-amino-3-(2,5-dioxopyrrolidin-3-yl)sulfanylpropanoic acid |
| SMILES | N[C@H](CSC1CC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C7H10N2O4S/c8-3(7(12)13)2-14-4-1-5(10)9-6(4)11/h3-4H,1-2,8H2,(H,12,13)(H,9,10,11)/t3-,4?/m1/s1 |
| InChIKey | MGHIUUMYRIFPLD-SYPWQXSBSA-N |
| XLogP | -1.45 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|