C8H11NO4S — CID 71200967
2-amino-3-(3-hydroxy-4-oxocyclopent-2-en-1-yl)sulfanylpropanoic acid (PubChem CID 71200967) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-amino-3-(3-hydroxy-4-oxocyclopent-2-en-1-yl)sulfanylpropanoic acid.
| Compound Name | 2-amino-3-(3-hydroxy-4-oxocyclopent-2-en-1-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 71200967 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-amino-3-(3-hydroxy-4-oxocyclopent-2-en-1-yl)sulfanylpropanoic acid |
| SMILES | NC(CSC1C=C(O)C(=O)C1)C(=O)O |
| InChI | InChI=1S/C8H11NO4S/c9-5(8(12)13)3-14-4-1-6(10)7(11)2-4/h1,4-5,10H,2-3,9H2,(H,12,13) |
| InChIKey | HNUCZBADZGTEEF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |