(2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid

C11H21NO2S — CID 64736894

IUPAC(2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid
SMILESCC1CC(C)CC(SC[C@H](N)C(=O)O)C1
InChIInChI=1S/C11H21NO2S/c1-7-3-8(2)5-9(4-7)15-6-10(12)11(13)14/h7-10H,3-6,12H2,1-2H3,(H,13,14)/t7?,8?,9?,10-/m0/s1
InChIKeyMLKKPCPVWPOQKG-VVIYDGDNSA-N
MW231.36 g/mol
LogP1.96
Rot. Bonds4

About (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid

(2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid (PubChem CID 64736894) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid
PubChem CID64736894
Molecular FormulaC11H21NO2S
Molecular Weight231.36 g/mol
Exact Mass231.13
IUPAC Name(2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid
SMILESCC1CC(C)CC(SC[C@H](N)C(=O)O)C1
InChIInChI=1S/C11H21NO2S/c1-7-3-8(2)5-9(4-7)15-6-10(12)11(13)14/h7-10H,3-6,12H2,1-2H3,(H,13,14)/t7?,8?,9?,10-/m0/s1
InChIKeyMLKKPCPVWPOQKG-VVIYDGDNSA-N
XLogP1.96
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.36
LogP ≤ 51.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid?
The IUPAC name of (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid (CID 64736894) is (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid?
The canonical SMILES for (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid is CC1CC(C)CC(SC[C@H](N)C(=O)O)C1.
What is the InChIKey of (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid?
The InChIKey is MLKKPCPVWPOQKG-VVIYDGDNSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-7-3-8(2)5-9(4-7)15-6-10(12)11(13)14/h7-10H,3-6,12H2,1-2H3,(H,13,14)/t7?,8?,9?,10-/m0/s1.
What are the key properties of (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid?
(2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid has a molecular weight of 231.36 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(3,5-dimethylcyclohexyl)sulfanylpropanoic acid is sourced from PubChem (CID 64736894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).