C10H10O6 — CID 11834613
3,3,4,4-tetrahydroxy-5-phenyloxolan-2-one (PubChem CID 11834613) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is 3,3,4,4-tetrahydroxy-5-phenyloxolan-2-one.
| Compound Name | 3,3,4,4-tetrahydroxy-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 11834613 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3,3,4,4-tetrahydroxy-5-phenyloxolan-2-one |
| SMILES | O=C1OC(c2ccccc2)C(O)(O)C1(O)O |
| InChI | InChI=1S/C10H10O6/c11-8-10(14,15)9(12,13)7(16-8)6-4-2-1-3-5-6/h1-5,7,12-15H |
| InChIKey | FOCLNZOXVIYMFO-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|