C23H22N2O7S — CID 118351484
tert-butyl 6-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-3-oxo-1H-isoindole-2-carboxylate (PubChem CID 118351484) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is tert-butyl 6-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-3-oxo-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 6-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-3-oxo-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 118351484 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | tert-butyl 6-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-3-oxo-1H-isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(S(=O)(=O)CCN3C(=O)c4ccccc4C3=O)ccc2C1=O |
| InChI | InChI=1S/C23H22N2O7S/c1-23(2,3)32-22(29)25-13-14-12-15(8-9-16(14)19(25)26)33(30,31)11-10-24-20(27)17-6-4-5-7-18(17)21(24)28/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | URDWRXMUJIEYGW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|