C14H24O8 — CID 118353295
(2S,3S,4S,5R,6S)-6-(2,3,3,4,4,5-hexadeuterio-2-propylpentanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 118353295) has the molecular formula C14H24O8 and a molecular weight of 326.37 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-(2,3,3,4,4,5-hexadeuterio-2-propylpentanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-(2,3,3,4,4,5-hexadeuterio-2-propylpentanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118353295 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-(2,3,3,4,4,5-hexadeuterio-2-propylpentanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | [2H]CC([2H])([2H])C([2H])([2H])C([2H])(CCC)C(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H24O8/c1-3-5-7(6-4-2)13(20)22-14-10(17)8(15)9(16)11(21-14)12(18)19/h7-11,14-17H,3-6H2,1-2H3,(H,18,19)/t8-,9-,10+,11-,14-/m0/s1/i1D,3D2,5D2,7D/t7?,8-,9-,10+,11-,14- |
| InChIKey | XXKSYIHWRBBHIC-VJXGITITSA-N |
| XLogP | -0.36 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |