C17H30O8 — CID 139024666
(3R,6S)-3,4,5-trihydroxy-6-[(2S)-2-propyloctanoyl]oxyoxane-2-carboxylic acid (PubChem CID 139024666) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is (3R,6S)-3,4,5-trihydroxy-6-[(2S)-2-propyloctanoyl]oxyoxane-2-carboxylic acid.
| Compound Name | (3R,6S)-3,4,5-trihydroxy-6-[(2S)-2-propyloctanoyl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 139024666 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (3R,6S)-3,4,5-trihydroxy-6-[(2S)-2-propyloctanoyl]oxyoxane-2-carboxylic acid |
| SMILES | CCCCCC[C@H](CCC)C(=O)O[C@@H]1OC(C(=O)O)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C17H30O8/c1-3-5-6-7-9-10(8-4-2)16(23)25-17-13(20)11(18)12(19)14(24-17)15(21)22/h10-14,17-20H,3-9H2,1-2H3,(H,21,22)/t10-,11?,12+,13?,14?,17-/m0/s1 |
| InChIKey | QKASJXSEOIADTC-PANLFQAHSA-N |
| XLogP | 0.81 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|