About 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide
1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide (PubChem CID 118357000) has the molecular formula C7H8F3N3O
and a molecular weight of 207.16 g/mol. Its IUPAC name is 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide.
Molecular Properties
| Compound Name | 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide |
| PubChem CID | 118357000 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide |
| SMILES | NC(=O)c1nccn1C(CF)C(F)F |
| InChI | InChI=1S/C7H8F3N3O/c8-3-4(5(9)10)13-2-1-12-7(13)6(11)14/h1-2,4-5H,3H2,(H2,11,14) |
| InChIKey | IDPBGQXAGOJPKC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide?
The IUPAC name of 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide (CID 118357000) is 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide.
What is the SMILES notation for 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide?
The canonical SMILES for 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide is NC(=O)c1nccn1C(CF)C(F)F.
What is the InChIKey of 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide?
The InChIKey is IDPBGQXAGOJPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O/c8-3-4(5(9)10)13-2-1-12-7(13)6(11)14/h1-2,4-5H,3H2,(H2,11,14).
What are the key properties of 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide?
1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide has a molecular weight of 207.16 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1,3-trifluoropropan-2-yl)imidazole-2-carboxamide is sourced from PubChem (CID 118357000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).