C22H25FN2O3 — CID 118359714
methyl 5-cyclopropyl-2-fluoro-4-[(3R)-1-(5-methyl-2-pyridinyl)piperidin-3-yl]oxybenzoate (PubChem CID 118359714) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-fluoro-4-[(3R)-1-(5-methyl-2-pyridinyl)piperidin-3-yl]oxybenzoate.
| Compound Name | methyl 5-cyclopropyl-2-fluoro-4-[(3R)-1-(5-methyl-2-pyridinyl)piperidin-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 118359714 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl 5-cyclopropyl-2-fluoro-4-[(3R)-1-(5-methyl-2-pyridinyl)piperidin-3-yl]oxybenzoate |
| SMILES | COC(=O)c1cc(C2CC2)c(O[C@@H]2CCCN(c3ccc(C)cn3)C2)cc1F |
| InChI | InChI=1S/C22H25FN2O3/c1-14-5-8-21(24-12-14)25-9-3-4-16(13-25)28-20-11-19(23)18(22(26)27-2)10-17(20)15-6-7-15/h5,8,10-12,15-16H,3-4,6-7,9,13H2,1-2H3/t16-/m1/s1 |
| InChIKey | BJKFEDNAGBPAKC-MRXNPFEDSA-N |
| XLogP | 4.24 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |