C38H41FN10O4 — CID 118361506
4-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)-6-(3-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 118361506) has the molecular formula C38H41FN10O4 and a molecular weight of 720.81 g/mol. Its IUPAC name is 4-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)-6-(3-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | 4-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)-6-(3-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 118361506 |
| Molecular Formula | C38H41FN10O4 |
| Molecular Weight | 720.81 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 4-[3-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]-N-(3-fluoro-4-morpholin-4-ylphenyl)-6-(3-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc(-c2nc(Nc3cccc(N4CCOCC4)c3)nc3n[nH]c(C(=O)Nc4ccc(N5CCOCC5)c(F)c4)c23)c1 |
| InChI | InChI=1S/C38H41FN10O4/c1-47(2)13-5-10-32(50)40-26-7-3-6-25(22-26)34-33-35(37(51)41-28-11-12-31(30(39)24-28)49-16-20-53-21-17-49)45-46-36(33)44-38(43-34)42-27-8-4-9-29(23-27)48-14-18-52-19-15-48/h3-12,22-24H,13-21H2,1-2H3,(H,40,50)(H,41,51)(H2,42,43,44,45,46)/b10-5+ |
| InChIKey | VOENOZWKTMDEON-BJMVGYQFSA-N |
| XLogP | 4.88 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.81 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|