C27H29ClIN9O — CID 149366686
(E)-N-[3-chloro-5-[6-[3-(4-iodopiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 149366686) has the molecular formula C27H29ClIN9O and a molecular weight of 657.95 g/mol. Its IUPAC name is (E)-N-[3-chloro-5-[6-[3-(4-iodopiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[3-chloro-5-[6-[3-(4-iodopiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 149366686 |
| Molecular Formula | C27H29ClIN9O |
| Molecular Weight | 657.95 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | (E)-N-[3-chloro-5-[6-[3-(4-iodopiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc(Cl)cc(-c2nc(Nc3cccc(N4CCN(I)CC4)c3)nc3[nH]ncc23)c1 |
| InChI | InChI=1S/C27H29ClIN9O/c1-36(2)8-4-7-24(39)31-21-14-18(13-19(28)15-21)25-23-17-30-35-26(23)34-27(33-25)32-20-5-3-6-22(16-20)37-9-11-38(29)12-10-37/h3-7,13-17H,8-12H2,1-2H3,(H,31,39)(H2,30,32,33,34,35)/b7-4+ |
| InChIKey | YIZLIXFSJIDUSK-QPJJXVBHSA-N |
| XLogP | 4.95 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|