About N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide
N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide (PubChem CID 118361977) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide.
Molecular Properties
| Compound Name | N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide |
| PubChem CID | 118361977 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide |
| SMILES | CC(C)(C)NNC(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(2,3)7(13)8(14)11-12-10(4,5)6/h12H,1-6H3,(H,11,14) |
| InChIKey | SATMWSSUPHOEMF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide?
The IUPAC name of N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide (CID 118361977) is N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide.
What is the SMILES notation for N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide?
The canonical SMILES for N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide is CC(C)(C)NNC(=O)C(=O)C(C)(C)C.
What is the InChIKey of N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide?
The InChIKey is SATMWSSUPHOEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-9(2,3)7(13)8(14)11-12-10(4,5)6/h12H,1-6H3,(H,11,14).
What are the key properties of N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide?
N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide has a molecular weight of 200.28 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide is sourced from PubChem (CID 118361977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).