C10H20N2O2 — CID 118361977
N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide (PubChem CID 118361977) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide.
| Compound Name | N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide |
|---|---|
| PubChem CID | 118361977 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N'-tert-butyl-3,3-dimethyl-2-oxobutanehydrazide |
| SMILES | CC(C)(C)NNC(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(2,3)7(13)8(14)11-12-10(4,5)6/h12H,1-6H3,(H,11,14) |
| InChIKey | SATMWSSUPHOEMF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|