C22H24N4O3 — CID 118363729
[2-[4-(2-aminoethylamino)quinolin-2-yl]-1,3,4,5-tetrahydro-2-benzazepin-8-yl] hydrogen carbonate (PubChem CID 118363729) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is [2-[4-(2-aminoethylamino)quinolin-2-yl]-1,3,4,5-tetrahydro-2-benzazepin-8-yl] hydrogen carbonate.
| Compound Name | [2-[4-(2-aminoethylamino)quinolin-2-yl]-1,3,4,5-tetrahydro-2-benzazepin-8-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118363729 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [2-[4-(2-aminoethylamino)quinolin-2-yl]-1,3,4,5-tetrahydro-2-benzazepin-8-yl] hydrogen carbonate |
| SMILES | NCCNc1cc(N2CCCc3ccc(OC(=O)O)cc3C2)nc2ccccc12 |
| InChI | InChI=1S/C22H24N4O3/c23-9-10-24-20-13-21(25-19-6-2-1-5-18(19)20)26-11-3-4-15-7-8-17(29-22(27)28)12-16(15)14-26/h1-2,5-8,12-13H,3-4,9-11,14,23H2,(H,24,25)(H,27,28) |
| InChIKey | VIWQGCPHXDFLST-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|