C25H30N2O4 — CID 11836828
[1-(2-hydroxy-3-morpholin-4-ylpropyl)-3,5-dimethylindol-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 11836828) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [1-(2-hydroxy-3-morpholin-4-ylpropyl)-3,5-dimethylindol-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(2-hydroxy-3-morpholin-4-ylpropyl)-3,5-dimethylindol-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 11836828 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [1-(2-hydroxy-3-morpholin-4-ylpropyl)-3,5-dimethylindol-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(C)c3cc(C)ccc3n2CC(O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-17-4-9-23-22(14-17)18(2)24(25(29)19-5-7-21(30-3)8-6-19)27(23)16-20(28)15-26-10-12-31-13-11-26/h4-9,14,20,28H,10-13,15-16H2,1-3H3 |
| InChIKey | SWMHBPGXLQZCIH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|