C15H26O — CID 118370472
3-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]heptane (PubChem CID 118370472) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 3-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]heptane.
| Compound Name | 3-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]heptane |
|---|---|
| PubChem CID | 118370472 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 3-[[(2Z,4Z)-hepta-2,4,6-trienoxy]methyl]heptane |
| SMILES | C=C/C=C\C=C/COCC(CC)CCCC |
| InChI | InChI=1S/C15H26O/c1-4-7-9-10-11-13-16-14-15(6-3)12-8-5-2/h4,7,9-11,15H,1,5-6,8,12-14H2,2-3H3/b9-7-,11-10- |
| InChIKey | HHUGQQSBEYRPGE-MNAJIYKBSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|