C19H19N3O4S — CID 118371994
diethyl 4-(4-methylanilino)thieno[2,3-d]pyrimidine-5,6-dicarboxylate (PubChem CID 118371994) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is diethyl 4-(4-methylanilino)thieno[2,3-d]pyrimidine-5,6-dicarboxylate.
| Compound Name | diethyl 4-(4-methylanilino)thieno[2,3-d]pyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 118371994 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | diethyl 4-(4-methylanilino)thieno[2,3-d]pyrimidine-5,6-dicarboxylate |
| SMILES | CCOC(=O)c1sc2ncnc(Nc3ccc(C)cc3)c2c1C(=O)OCC |
| InChI | InChI=1S/C19H19N3O4S/c1-4-25-18(23)13-14-16(22-12-8-6-11(3)7-9-12)20-10-21-17(14)27-15(13)19(24)26-5-2/h6-10H,4-5H2,1-3H3,(H,20,21,22) |
| InChIKey | YRKQMNRNZVALSL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |