C20H32N6O3 — CID 118377594
tert-butyl 3-[9-ethyl-8-[methyl(propan-2-yl)amino]purin-6-yl]oxypyrrolidine-1-carboxylate (PubChem CID 118377594) has the molecular formula C20H32N6O3 and a molecular weight of 404.52 g/mol. Its IUPAC name is tert-butyl 3-[9-ethyl-8-[methyl(propan-2-yl)amino]purin-6-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[9-ethyl-8-[methyl(propan-2-yl)amino]purin-6-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118377594 |
| Molecular Formula | C20H32N6O3 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | tert-butyl 3-[9-ethyl-8-[methyl(propan-2-yl)amino]purin-6-yl]oxypyrrolidine-1-carboxylate |
| SMILES | CCn1c(N(C)C(C)C)nc2c(OC3CCN(C(=O)OC(C)(C)C)C3)ncnc21 |
| InChI | InChI=1S/C20H32N6O3/c1-8-26-16-15(23-18(26)24(7)13(2)3)17(22-12-21-16)28-14-9-10-25(11-14)19(27)29-20(4,5)6/h12-14H,8-11H2,1-7H3 |
| InChIKey | SNICXTJQHFPLOR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |