C23H36N6O4 — CID 130333092
tert-butyl (3S)-3-[8-[(cyclohexylamino)-hydroxymethyl]-9-ethylpurin-6-yl]oxypyrrolidine-1-carboxylate (PubChem CID 130333092) has the molecular formula C23H36N6O4 and a molecular weight of 460.58 g/mol. Its IUPAC name is tert-butyl (3S)-3-[8-[(cyclohexylamino)-hydroxymethyl]-9-ethylpurin-6-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[8-[(cyclohexylamino)-hydroxymethyl]-9-ethylpurin-6-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130333092 |
| Molecular Formula | C23H36N6O4 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | tert-butyl (3S)-3-[8-[(cyclohexylamino)-hydroxymethyl]-9-ethylpurin-6-yl]oxypyrrolidine-1-carboxylate |
| SMILES | CCn1c(C(O)NC2CCCCC2)nc2c(O[C@H]3CCN(C(=O)OC(C)(C)C)C3)ncnc21 |
| InChI | InChI=1S/C23H36N6O4/c1-5-29-18-17(27-19(29)20(30)26-15-9-7-6-8-10-15)21(25-14-24-18)32-16-11-12-28(13-16)22(31)33-23(2,3)4/h14-16,20,26,30H,5-13H2,1-4H3/t16-,20?/m0/s1 |
| InChIKey | HFBVSVHZPLVXHN-DJZRFWRSSA-N |
| XLogP | 3.15 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|