C16H24N6O4 — CID 135309530
3-[9-ethyl-8-[2-methoxyethyl(methyl)amino]purin-6-yl]oxypyrrolidine-1-carboxylic acid (PubChem CID 135309530) has the molecular formula C16H24N6O4 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[9-ethyl-8-[2-methoxyethyl(methyl)amino]purin-6-yl]oxypyrrolidine-1-carboxylic acid.
| Compound Name | 3-[9-ethyl-8-[2-methoxyethyl(methyl)amino]purin-6-yl]oxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135309530 |
| Molecular Formula | C16H24N6O4 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[9-ethyl-8-[2-methoxyethyl(methyl)amino]purin-6-yl]oxypyrrolidine-1-carboxylic acid |
| SMILES | CCn1c(N(C)CCOC)nc2c(OC3CCN(C(=O)O)C3)ncnc21 |
| InChI | InChI=1S/C16H24N6O4/c1-4-22-13-12(19-15(22)20(2)7-8-25-3)14(18-10-17-13)26-11-5-6-21(9-11)16(23)24/h10-11H,4-9H2,1-3H3,(H,23,24) |
| InChIKey | AYQKCPPMFMPFJG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |