C11H13N5O3 — CID 135309552
3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid (PubChem CID 135309552) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid.
| Compound Name | 3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135309552 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-(9-methylpurin-6-yl)oxypyrrolidine-1-carboxylic acid |
| SMILES | Cn1cnc2c(OC3CCN(C(=O)O)C3)ncnc21 |
| InChI | InChI=1S/C11H13N5O3/c1-15-6-14-8-9(15)12-5-13-10(8)19-7-2-3-16(4-7)11(17)18/h5-7H,2-4H2,1H3,(H,17,18) |
| InChIKey | MPXISLVBISKHEO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |