C17H15ClFN5O2 — CID 118385836
2-[(8S)-8-[(5-chloropyrimidin-2-yl)amino]-2-fluoro-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]acetic acid (PubChem CID 118385836) has the molecular formula C17H15ClFN5O2 and a molecular weight of 375.79 g/mol. Its IUPAC name is 2-[(8S)-8-[(5-chloropyrimidin-2-yl)amino]-2-fluoro-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]acetic acid.
| Compound Name | 2-[(8S)-8-[(5-chloropyrimidin-2-yl)amino]-2-fluoro-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]acetic acid |
|---|---|
| PubChem CID | 118385836 |
| Molecular Formula | C17H15ClFN5O2 |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[(8S)-8-[(5-chloropyrimidin-2-yl)amino]-2-fluoro-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3nc(F)ccc31)C[C@@H](Nc1ncc(Cl)cn1)CC2 |
| InChI | InChI=1S/C17H15ClFN5O2/c18-9-6-20-17(21-7-9)22-10-1-2-12-11(5-10)16-13(3-4-14(19)23-16)24(12)8-15(25)26/h3-4,6-7,10H,1-2,5,8H2,(H,25,26)(H,20,21,22)/t10-/m0/s1 |
| InChIKey | PYJZJXZTJBBION-JTQLQIEISA-N |
| XLogP | 2.67 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|