C11H15N2O8P — CID 118387129
2-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclobutyl]oxy-2-phosphonoacetic acid (PubChem CID 118387129) has the molecular formula C11H15N2O8P and a molecular weight of 334.22 g/mol. Its IUPAC name is 2-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclobutyl]oxy-2-phosphonoacetic acid.
| Compound Name | 2-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclobutyl]oxy-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 118387129 |
| Molecular Formula | C11H15N2O8P |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)cyclobutyl]oxy-2-phosphonoacetic acid |
| SMILES | Cc1cn(C2CC(OC(C(=O)O)P(=O)(O)O)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N2O8P/c1-5-4-13(11(17)12-8(5)14)6-2-7(3-6)21-10(9(15)16)22(18,19)20/h4,6-7,10H,2-3H2,1H3,(H,15,16)(H,12,14,17)(H2,18,19,20) |
| InChIKey | WKMIIXHIJFBDLD-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|