C10H14N3O6P — CID 46231862
[3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrrolidine-1-carbonyl]phosphonic acid (PubChem CID 46231862) has the molecular formula C10H14N3O6P and a molecular weight of 303.21 g/mol. Its IUPAC name is [3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrrolidine-1-carbonyl]phosphonic acid.
| Compound Name | [3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrrolidine-1-carbonyl]phosphonic acid |
|---|---|
| PubChem CID | 46231862 |
| Molecular Formula | C10H14N3O6P |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [3-(5-methyl-2,4-dioxopyrimidin-1-yl)pyrrolidine-1-carbonyl]phosphonic acid |
| SMILES | Cc1cn(C2CCN(C(=O)P(=O)(O)O)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N3O6P/c1-6-4-13(9(15)11-8(6)14)7-2-3-12(5-7)10(16)20(17,18)19/h4,7H,2-3,5H2,1H3,(H,11,14,15)(H2,17,18,19) |
| InChIKey | DOXKBGLOKWJXDU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|