C18H30O4 — CID 118392336
butyl 5-methyl-2,5-di(propan-2-yl)-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate (PubChem CID 118392336) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is butyl 5-methyl-2,5-di(propan-2-yl)-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate.
| Compound Name | butyl 5-methyl-2,5-di(propan-2-yl)-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate |
|---|---|
| PubChem CID | 118392336 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | butyl 5-methyl-2,5-di(propan-2-yl)-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate |
| SMILES | CCCCOC(=O)C1CC(C)(C(C)C)C23OC2(O3)C1C(C)C |
| InChI | InChI=1S/C18H30O4/c1-7-8-9-20-15(19)13-10-16(6,12(4)5)18-17(21-18,22-18)14(13)11(2)3/h11-14H,7-10H2,1-6H3 |
| InChIKey | SGCLOEYEJCDSAC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|