C16H20ClN3O — CID 118392663
5-chloro-2-[(1-methylcyclopropyl)amino]-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide (PubChem CID 118392663) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 5-chloro-2-[(1-methylcyclopropyl)amino]-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-2-[(1-methylcyclopropyl)amino]-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118392663 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-chloro-2-[(1-methylcyclopropyl)amino]-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide |
| SMILES | C#C[C@@](C)(CC)NC(=O)c1cc(Cl)cnc1NC1(C)CC1 |
| InChI | InChI=1S/C16H20ClN3O/c1-5-15(3,6-2)20-14(21)12-9-11(17)10-18-13(12)19-16(4)7-8-16/h1,9-10H,6-8H2,2-4H3,(H,18,19)(H,20,21)/t15-/m0/s1 |
| InChIKey | QFUKWPCEXGKDTI-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|