C15H19N4O6PS — CID 118395397
[[4-(diaminomethylideneamino)phenyl]-[(4-methoxyphenyl)sulfonylamino]methyl]phosphonic acid (PubChem CID 118395397) has the molecular formula C15H19N4O6PS and a molecular weight of 414.38 g/mol. Its IUPAC name is [[4-(diaminomethylideneamino)phenyl]-[(4-methoxyphenyl)sulfonylamino]methyl]phosphonic acid.
| Compound Name | [[4-(diaminomethylideneamino)phenyl]-[(4-methoxyphenyl)sulfonylamino]methyl]phosphonic acid |
|---|---|
| PubChem CID | 118395397 |
| Molecular Formula | C15H19N4O6PS |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [[4-(diaminomethylideneamino)phenyl]-[(4-methoxyphenyl)sulfonylamino]methyl]phosphonic acid |
| SMILES | COc1ccc(S(=O)(=O)NC(c2ccc(N=C(N)N)cc2)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C15H19N4O6PS/c1-25-12-6-8-13(9-7-12)27(23,24)19-14(26(20,21)22)10-2-4-11(5-3-10)18-15(16)17/h2-9,14,19H,1H3,(H4,16,17,18)(H2,20,21,22) |
| InChIKey | BBSGGFRQWLWKHC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 177.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|