C18H24N5O5P — CID 118404211
(4aR,6R,7S,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropoxy)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-7-carbonitrile (PubChem CID 118404211) has the molecular formula C18H24N5O5P and a molecular weight of 421.40 g/mol. Its IUPAC name is (4aR,6R,7S,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropoxy)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-7-carbonitrile.
| Compound Name | (4aR,6R,7S,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropoxy)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-7-carbonitrile |
|---|---|
| PubChem CID | 118404211 |
| Molecular Formula | C18H24N5O5P |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (4aR,6R,7S,7aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropoxy)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinine-7-carbonitrile |
| SMILES | C[C@]1([C@H]2[C@@H](COP(=O)(O2)OCC(C)(C)C)O[C@H]1C3=CC=C4N3N=CN=C4N)C#N |
| InChI | InChI=1S/C18H24N5O5P/c1-17(2,3)9-26-29(24)25-7-13-15(28-29)18(4,8-19)14(27-13)11-5-6-12-16(20)21-10-22-23(11)12/h5-6,10,13-15H,7,9H2,1-4H3,(H2,20,21,22)/t13-,14+,15-,18+,29?/m1/s1 |
| InChIKey | IZLFATBDJXLJSE-HQZBKWGJSA-N |
| XLogP | 0.60 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 738 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|