About 3-dec-1-enoxypentane-2,4-dione
3-dec-1-enoxypentane-2,4-dione (PubChem CID 118406213) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-dec-1-enoxypentane-2,4-dione.
Molecular Properties
| Compound Name | 3-dec-1-enoxypentane-2,4-dione |
| PubChem CID | 118406213 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3-dec-1-enoxypentane-2,4-dione |
| SMILES | CCCCCCCCC=COC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H26O3/c1-4-5-6-7-8-9-10-11-12-18-15(13(2)16)14(3)17/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | VREJRVSYSHWNAR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-dec-1-enoxypentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dec-1-enoxypentane-2,4-dione?
The IUPAC name of 3-dec-1-enoxypentane-2,4-dione (CID 118406213) is 3-dec-1-enoxypentane-2,4-dione.
What is the SMILES notation for 3-dec-1-enoxypentane-2,4-dione?
The canonical SMILES for 3-dec-1-enoxypentane-2,4-dione is CCCCCCCCC=COC(C(C)=O)C(C)=O.
What is the InChIKey of 3-dec-1-enoxypentane-2,4-dione?
The InChIKey is VREJRVSYSHWNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-4-5-6-7-8-9-10-11-12-18-15(13(2)16)14(3)17/h11-12,15H,4-10H2,1-3H3.
What are the key properties of 3-dec-1-enoxypentane-2,4-dione?
3-dec-1-enoxypentane-2,4-dione has a molecular weight of 254.37 g/mol, XLogP of 3.81, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dec-1-enoxypentane-2,4-dione is sourced from PubChem (CID 118406213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).