C28H33ClFNO5 — CID 118406665
(1S,2S,4S,5R,6R,9R,12S)-4-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide (PubChem CID 118406665) has the molecular formula C28H33ClFNO5 and a molecular weight of 518.03 g/mol. Its IUPAC name is (1S,2S,4S,5R,6R,9R,12S)-4-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide.
| Compound Name | (1S,2S,4S,5R,6R,9R,12S)-4-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide |
|---|---|
| PubChem CID | 118406665 |
| Molecular Formula | C28H33ClFNO5 |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (1S,2S,4S,5R,6R,9R,12S)-4-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide |
| SMILES | C=C1C[C@]23C[C@@]1(O)CC[C@H]2C1=C[C@@H](OC)[C@H](O)[C@@](C)(C(C)=O)C1[C@@H]3C(=O)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C28H33ClFNO5/c1-14-11-27-13-28(14,35)8-7-18(27)17-10-21(36-4)24(33)26(3,15(2)32)22(17)23(27)25(34)31-12-16-5-6-20(30)19(29)9-16/h5-6,9-10,18,21-24,33,35H,1,7-8,11-13H2,2-4H3,(H,31,34)/t18-,21+,22?,23+,24-,26-,27-,28-/m0/s1 |
| InChIKey | YFWLBSLLHRHNHF-QMGUTPDASA-N |
| XLogP | 3.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|