C27H31ClFNO5 — CID 138655666
(1S,2S,4S,5R,6R,9R,12S)-N-[(3-chloro-4-fluorophenyl)methyl]-4-formyl-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide (PubChem CID 138655666) has the molecular formula C27H31ClFNO5 and a molecular weight of 504.00 g/mol. Its IUPAC name is (1S,2S,4S,5R,6R,9R,12S)-N-[(3-chloro-4-fluorophenyl)methyl]-4-formyl-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide.
| Compound Name | (1S,2S,4S,5R,6R,9R,12S)-N-[(3-chloro-4-fluorophenyl)methyl]-4-formyl-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide |
|---|---|
| PubChem CID | 138655666 |
| Molecular Formula | C27H31ClFNO5 |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (1S,2S,4S,5R,6R,9R,12S)-N-[(3-chloro-4-fluorophenyl)methyl]-4-formyl-5,12-dihydroxy-6-methoxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2-carboxamide |
| SMILES | C=C1C[C@]23C[C@@]1(O)CC[C@H]2C1=C[C@@H](OC)[C@H](O)[C@@](C)(C=O)C1[C@@H]3C(=O)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C27H31ClFNO5/c1-14-10-26-12-27(14,34)7-6-17(26)16-9-20(35-3)23(32)25(2,13-31)21(16)22(26)24(33)30-11-15-4-5-19(29)18(28)8-15/h4-5,8-9,13,17,20-23,32,34H,1,6-7,10-12H2,2-3H3,(H,30,33)/t17-,20+,21?,22+,23-,25-,26-,27-/m0/s1 |
| InChIKey | WLWUTBKAXMRTEA-QLRCWWSJSA-N |
| XLogP | 3.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|