C12H26N4O2 — CID 118409020
(NE)-N-[1-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]propan-2-ylidene]hydroxylamine (PubChem CID 118409020) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is (NE)-N-[1-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]propan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 118409020 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (NE)-N-[1-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]propan-2-ylidene]hydroxylamine |
| SMILES | C/C(CNCC(C)(C)CN[C@@H](C)/C(C)=N/O)=N\O |
| InChI | InChI=1S/C12H26N4O2/c1-9(15-17)6-13-7-12(4,5)8-14-10(2)11(3)16-18/h10,13-14,17-18H,6-8H2,1-5H3/b15-9+,16-11+/t10-/m0/s1 |
| InChIKey | ZGVKAOGEAJSTJW-PFCJIYNHSA-N |
| XLogP | 1.28 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|