C14H28N4O2 — CID 144930683
(NE)-N-[(3S)-3-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]pent-4-en-2-ylidene]hydroxylamine (PubChem CID 144930683) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (NE)-N-[(3S)-3-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]pent-4-en-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3S)-3-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]pent-4-en-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 144930683 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (NE)-N-[(3S)-3-[[3-[[(2S,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]pent-4-en-2-ylidene]hydroxylamine |
| SMILES | C=C[C@H](NCC(C)(C)CN[C@@H](C)/C(C)=N/O)/C(C)=N/O |
| InChI | InChI=1S/C14H28N4O2/c1-7-13(12(4)18-20)16-9-14(5,6)8-15-10(2)11(3)17-19/h7,10,13,15-16,19-20H,1,8-9H2,2-6H3/b17-11+,18-12+/t10-,13-/m0/s1 |
| InChIKey | ZRLJSMXBMHUCFR-LRAUOPGSSA-N |
| XLogP | 1.84 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|