C16H36CoN6O2+2 — CID 135472000
N-[3-[(2-amino-2-methylpropyl)amino]butan-2-ylidene]hydroxylamine;N-[3-(2-amino-2-methylpropyl)iminobutan-2-ylidene]hydroxylamine;cobalt(2+) (PubChem CID 135472000) has the molecular formula C16H36CoN6O2+2 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[3-[(2-amino-2-methylpropyl)amino]butan-2-ylidene]hydroxylamine;N-[3-(2-amino-2-methylpropyl)iminobutan-2-ylidene]hydroxylamine;cobalt(2+).
| Compound Name | N-[3-[(2-amino-2-methylpropyl)amino]butan-2-ylidene]hydroxylamine;N-[3-(2-amino-2-methylpropyl)iminobutan-2-ylidene]hydroxylamine;cobalt(2+) |
|---|---|
| PubChem CID | 135472000 |
| Molecular Formula | C16H36CoN6O2+2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | N-[3-[(2-amino-2-methylpropyl)amino]butan-2-ylidene]hydroxylamine;N-[3-(2-amino-2-methylpropyl)iminobutan-2-ylidene]hydroxylamine;cobalt(2+) |
| SMILES | CC(=NO)/C(C)=N/CC(C)(C)N.CC(=NO)C(C)NCC(C)(C)N.[Co+2] |
| InChI | InChI=1S/C8H19N3O.C8H17N3O.Co/c2*1-6(7(2)11-12)10-5-8(3,4)9;/h6,10,12H,5,9H2,1-4H3;12H,5,9H2,1-4H3;/q;;+2/b;10-6+,11-7?; |
| InChIKey | WNWPBZDWUKIUTK-QOERDDSPSA-N |
| XLogP | 1.58 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|