About bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+)
bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) (PubChem CID 135459891) has the molecular formula C14H30CoN6O2+2
and a molecular weight of 373.37 g/mol. Its IUPAC name is bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+).
Molecular Properties
| Compound Name | bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) |
| PubChem CID | 135459891 |
| Molecular Formula | C14H30CoN6O2+2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) |
| SMILES | CC(=NO)/C(C)=N/CCCN.CC(=NO)/C(C)=N/CCCN.[Co+2] |
| InChI | InChI=1S/2C7H15N3O.Co/c2*1-6(7(2)10-11)9-5-3-4-8;/h2*11H,3-5,8H2,1-2H3;/q;;+2/b2*9-6+,10-7?; |
| InChIKey | WPXUPBGWESEDQQ-OKUAGALGSA-N |
| XLogP | 1.29 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+)?
The IUPAC name of bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) (CID 135459891) is bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+).
What is the SMILES notation for bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+)?
The canonical SMILES for bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) is CC(=NO)/C(C)=N/CCCN.CC(=NO)/C(C)=N/CCCN.[Co+2].
What is the InChIKey of bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+)?
The InChIKey is WPXUPBGWESEDQQ-OKUAGALGSA-N. The full InChI is InChI=1S/2C7H15N3O.Co/c2*1-6(7(2)10-11)9-5-3-4-8;/h2*11H,3-5,8H2,1-2H3;/q;;+2/b2*9-6+,10-7?;.
What are the key properties of bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+)?
bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) has a molecular weight of 373.37 g/mol, XLogP of 1.29, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-[3-(3-aminopropylimino)butan-2-ylidene]hydroxylamine);cobalt(2+) is sourced from PubChem (CID 135459891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).