C10H18FeN4O2+2 — CID 135801394
(NZ)-N-[3-[2-[[(3Z)-3-hydroxyiminobutan-2-ylidene]amino]ethylimino]butan-2-ylidene]hydroxylamine;iron(2+) (PubChem CID 135801394) has the molecular formula C10H18FeN4O2+2 and a molecular weight of 282.12 g/mol. Its IUPAC name is (NZ)-N-[3-[2-[[(3Z)-3-hydroxyiminobutan-2-ylidene]amino]ethylimino]butan-2-ylidene]hydroxylamine;iron(2+).
| Compound Name | (NZ)-N-[3-[2-[[(3Z)-3-hydroxyiminobutan-2-ylidene]amino]ethylimino]butan-2-ylidene]hydroxylamine;iron(2+) |
|---|---|
| PubChem CID | 135801394 |
| Molecular Formula | C10H18FeN4O2+2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (NZ)-N-[3-[2-[[(3Z)-3-hydroxyiminobutan-2-ylidene]amino]ethylimino]butan-2-ylidene]hydroxylamine;iron(2+) |
| SMILES | CC(=N/O)/C(C)=N/CC/N=C(C)/C(C)=N\O.[Fe+2] |
| InChI | InChI=1S/C10H18N4O2.Fe/c1-7(9(3)13-15)11-5-6-12-8(2)10(4)14-16;/h15-16H,5-6H2,1-4H3;/q;+2/b11-7+,12-8+,13-9-,14-10-; |
| InChIKey | DKYQCZHMRKGINM-PMIPXZDPSA-N |
| XLogP | 1.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|