C10H16N4O2-2 — CID 5486308
3-N-oxido-2-N-[2-[[(3E)-3-oxidoiminobutan-2-ylidene]amino]ethyl]butane-2,3-diimine (PubChem CID 5486308) has the molecular formula C10H16N4O2-2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-N-oxido-2-N-[2-[[(3E)-3-oxidoiminobutan-2-ylidene]amino]ethyl]butane-2,3-diimine.
| Compound Name | 3-N-oxido-2-N-[2-[[(3E)-3-oxidoiminobutan-2-ylidene]amino]ethyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 5486308 |
| Molecular Formula | C10H16N4O2-2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-N-oxido-2-N-[2-[[(3E)-3-oxidoiminobutan-2-ylidene]amino]ethyl]butane-2,3-diimine |
| SMILES | CC(=N/[O-])/C(C)=N/CC/N=C(C)/C(C)=N/[O-] |
| InChI | InChI=1S/C10H18N4O2/c1-7(9(3)13-15)11-5-6-12-8(2)10(4)14-16/h15-16H,5-6H2,1-4H3/p-2/b11-7+,12-8+,13-9-,14-10+ |
| InChIKey | WBSLATNQBOWDSO-BFJUMDMWSA-L |
| XLogP | 1.83 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|