C14H28N4O2 — CID 137029652
N-[3-[2,2-dimethyl-3-(3-nitrosobutan-2-ylamino)propyl]iminopentan-2-ylidene]hydroxylamine (PubChem CID 137029652) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[3-[2,2-dimethyl-3-(3-nitrosobutan-2-ylamino)propyl]iminopentan-2-ylidene]hydroxylamine.
| Compound Name | N-[3-[2,2-dimethyl-3-(3-nitrosobutan-2-ylamino)propyl]iminopentan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137029652 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | N-[3-[2,2-dimethyl-3-(3-nitrosobutan-2-ylamino)propyl]iminopentan-2-ylidene]hydroxylamine |
| SMILES | CC/C(=N\CC(C)(C)CNC(C)C(C)N=O)C(C)=NO |
| InChI | InChI=1S/C14H28N4O2/c1-7-13(12(4)18-20)16-9-14(5,6)8-15-10(2)11(3)17-19/h10-11,15,20H,7-9H2,1-6H3/b16-13+,18-12? |
| InChIKey | WUDGJQBTIZLHTL-LUTDJHFOSA-N |
| XLogP | 2.85 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|