C12H30CoN6O2+3 — CID 6850067
bis(N-[3-(2-aminoethylamino)butan-2-ylidene]hydroxylamine);cobalt(3+) (PubChem CID 6850067) has the molecular formula C12H30CoN6O2+3 and a molecular weight of 349.35 g/mol. Its IUPAC name is bis(N-[3-(2-aminoethylamino)butan-2-ylidene]hydroxylamine);cobalt(3+).
| Compound Name | bis(N-[3-(2-aminoethylamino)butan-2-ylidene]hydroxylamine);cobalt(3+) |
|---|---|
| PubChem CID | 6850067 |
| Molecular Formula | C12H30CoN6O2+3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | bis(N-[3-(2-aminoethylamino)butan-2-ylidene]hydroxylamine);cobalt(3+) |
| SMILES | CC(=NO)C(C)NCCN.CC(=NO)C(C)NCCN.[Co+3] |
| InChI | InChI=1S/2C6H15N3O.Co/c2*1-5(6(2)9-10)8-4-3-7;/h2*5,8,10H,3-4,7H2,1-2H3;/q;;+3 |
| InChIKey | CQVHFWWQHKCYSN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|