C26H35NO7 — CID 118409827
methyl (2S,3S)-2-[[(1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carbonyl]amino]-3-methylpentanoate (PubChem CID 118409827) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is methyl (2S,3S)-2-[[(1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carbonyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[[(1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carbonyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 118409827 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | methyl (2S,3S)-2-[[(1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carbonyl]amino]-3-methylpentanoate |
| SMILES | C=C1C[C@]23C[C@]1(O)CC[C@H]2C1=C[C@@H]2OC(=O)[C@@](C)([C@H]1[C@@H]3C(=O)N[C@H](C(=O)OC)[C@@H](C)CC)[C@H]2O |
| InChI | InChI=1S/C26H35NO7/c1-6-12(2)19(22(30)33-5)27-21(29)18-17-14(9-16-20(28)24(17,4)23(31)34-16)15-7-8-26(32)11-25(15,18)10-13(26)3/h9,12,15-20,28,32H,3,6-8,10-11H2,1-2,4-5H3,(H,27,29)/t12-,15-,16-,17+,18+,19-,20-,24-,25-,26+/m0/s1 |
| InChIKey | YCOTVMPQYIFSNR-LOZULJAMSA-N |
| XLogP | 1.65 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|