C23H31NO6 — CID 118406740
(1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide (PubChem CID 118406740) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is (1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide.
| Compound Name | (1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide |
|---|---|
| PubChem CID | 118406740 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (1S,2S,3S,4S,7S,10R,13R,17R)-13,17-dihydroxy-N-(4-hydroxybutyl)-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide |
| SMILES | C=C1C[C@]23C[C@]1(O)CC[C@H]2C1=C[C@@H]2OC(=O)[C@@](C)([C@H]1[C@@H]3C(=O)NCCCCO)[C@H]2O |
| InChI | InChI=1S/C23H31NO6/c1-12-10-22-11-23(12,29)6-5-14(22)13-9-15-18(26)21(2,20(28)30-15)16(13)17(22)19(27)24-7-3-4-8-25/h9,14-18,25-26,29H,1,3-8,10-11H2,2H3,(H,24,27)/t14-,15-,16+,17+,18-,21-,22-,23+/m0/s1 |
| InChIKey | HOYREVIATRNQJY-MHEUMVOXSA-N |
| XLogP | 0.83 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|