C33H41NO17 — CID 118411091
methyl (2S,5S)-4-acetyloxy-3-hydroxy-2-(4-methyl-2-oxochromen-7-yl)oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 118411091) has the molecular formula C33H41NO17 and a molecular weight of 723.68 g/mol. Its IUPAC name is methyl (2S,5S)-4-acetyloxy-3-hydroxy-2-(4-methyl-2-oxochromen-7-yl)oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,5S)-4-acetyloxy-3-hydroxy-2-(4-methyl-2-oxochromen-7-yl)oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 118411091 |
| Molecular Formula | C33H41NO17 |
| Molecular Weight | 723.68 g/mol |
| Exact Mass | 723.24 |
| IUPAC Name | methyl (2S,5S)-4-acetyloxy-3-hydroxy-2-(4-methyl-2-oxochromen-7-yl)oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Oc2ccc3c(C)cc(=O)oc3c2)OC([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(=O)OC(C)(C)C)C(OC(C)=O)C1O |
| InChI | InChI=1S/C33H41NO17/c1-15-12-24(39)48-22-13-20(10-11-21(15)22)49-33(30(41)43-9)29(40)28(47-19(5)38)25(34-31(42)51-32(6,7)8)27(50-33)26(46-18(4)37)23(45-17(3)36)14-44-16(2)35/h10-13,23,25-29,40H,14H2,1-9H3,(H,34,42)/t23-,25+,26-,27?,28?,29?,33-/m1/s1 |
| InChIKey | ZDAAHFCSXLEWMW-IXJFXMHOSA-N |
| XLogP | 1.36 |
| TPSA | 238.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.68 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|