About (3-hex-3-enoyloxyphenyl) hex-3-enoate
(3-hex-3-enoyloxyphenyl) hex-3-enoate (PubChem CID 118415201) has the molecular formula C18H22O4
and a molecular weight of 302.37 g/mol. Its IUPAC name is (3-hex-3-enoyloxyphenyl) hex-3-enoate.
Molecular Properties
| Compound Name | (3-hex-3-enoyloxyphenyl) hex-3-enoate |
| PubChem CID | 118415201 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3-hex-3-enoyloxyphenyl) hex-3-enoate |
| SMILES | CCC=CCC(=O)Oc1cccc(OC(=O)CC=CCC)c1 |
| InChI | InChI=1S/C18H22O4/c1-3-5-7-12-17(19)21-15-10-9-11-16(14-15)22-18(20)13-8-6-4-2/h5-11,14H,3-4,12-13H2,1-2H3 |
| InChIKey | YDUZMLIWKWTVFR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hex-3-enoyloxyphenyl) hex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hex-3-enoyloxyphenyl) hex-3-enoate?
The IUPAC name of (3-hex-3-enoyloxyphenyl) hex-3-enoate (CID 118415201) is (3-hex-3-enoyloxyphenyl) hex-3-enoate.
What is the SMILES notation for (3-hex-3-enoyloxyphenyl) hex-3-enoate?
The canonical SMILES for (3-hex-3-enoyloxyphenyl) hex-3-enoate is CCC=CCC(=O)Oc1cccc(OC(=O)CC=CCC)c1.
What is the InChIKey of (3-hex-3-enoyloxyphenyl) hex-3-enoate?
The InChIKey is YDUZMLIWKWTVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O4/c1-3-5-7-12-17(19)21-15-10-9-11-16(14-15)22-18(20)13-8-6-4-2/h5-11,14H,3-4,12-13H2,1-2H3.
What are the key properties of (3-hex-3-enoyloxyphenyl) hex-3-enoate?
(3-hex-3-enoyloxyphenyl) hex-3-enoate has a molecular weight of 302.37 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hex-3-enoyloxyphenyl) hex-3-enoate is sourced from PubChem (CID 118415201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).