C19H13BrN2O2S — CID 118416876
1-[(4-bromo-1-benzothiophen-3-yl)methyl]-5-pyridin-3-ylpyrrole-2-carboxylic acid (PubChem CID 118416876) has the molecular formula C19H13BrN2O2S and a molecular weight of 413.30 g/mol. Its IUPAC name is 1-[(4-bromo-1-benzothiophen-3-yl)methyl]-5-pyridin-3-ylpyrrole-2-carboxylic acid.
| Compound Name | 1-[(4-bromo-1-benzothiophen-3-yl)methyl]-5-pyridin-3-ylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 118416876 |
| Molecular Formula | C19H13BrN2O2S |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 1-[(4-bromo-1-benzothiophen-3-yl)methyl]-5-pyridin-3-ylpyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cccnc2)n1Cc1csc2cccc(Br)c12 |
| InChI | InChI=1S/C19H13BrN2O2S/c20-14-4-1-5-17-18(14)13(11-25-17)10-22-15(6-7-16(22)19(23)24)12-3-2-8-21-9-12/h1-9,11H,10H2,(H,23,24) |
| InChIKey | DHGABLVVGJZJGV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |