C21H19ClN6O2S2 — CID 118424775
(5S)-5-[3-chloro-7-[4-(1H-pyrazol-5-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 118424775) has the molecular formula C21H19ClN6O2S2 and a molecular weight of 487.01 g/mol. Its IUPAC name is (5S)-5-[3-chloro-7-[4-(1H-pyrazol-5-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-7-[4-(1H-pyrazol-5-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 118424775 |
| Molecular Formula | C21H19ClN6O2S2 |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (5S)-5-[3-chloro-7-[4-(1H-pyrazol-5-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc3c(-c4ccc(-c5ccn[nH]5)cc4)nccc3c2Cl)CS1(=O)=O |
| InChI | InChI=1S/C21H19ClN6O2S2/c1-21(11-32(29,30)28(2)20(23)26-21)19-16(22)14-7-9-24-17(18(14)31-19)13-5-3-12(4-6-13)15-8-10-25-27-15/h3-10H,11H2,1-2H3,(H2,23,26)(H,25,27)/t21-/m0/s1 |
| InChIKey | LSZAARPKZRSGQZ-NRFANRHFSA-N |
| XLogP | 3.81 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |