C22H20ClFN6O2S2 — CID 118424782
(5S)-5-[3-chloro-7-[2-fluoro-4-(2-methylpyrazol-3-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 118424782) has the molecular formula C22H20ClFN6O2S2 and a molecular weight of 519.03 g/mol. Its IUPAC name is (5S)-5-[3-chloro-7-[2-fluoro-4-(2-methylpyrazol-3-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-7-[2-fluoro-4-(2-methylpyrazol-3-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 118424782 |
| Molecular Formula | C22H20ClFN6O2S2 |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | (5S)-5-[3-chloro-7-[2-fluoro-4-(2-methylpyrazol-3-yl)phenyl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc3c(-c4ccc(-c5ccnn5C)cc4F)nccc3c2Cl)CS1(=O)=O |
| InChI | InChI=1S/C22H20ClFN6O2S2/c1-22(11-34(31,32)30(3)21(25)28-22)20-17(23)14-6-8-26-18(19(14)33-20)13-5-4-12(10-15(13)24)16-7-9-27-29(16)2/h4-10H,11H2,1-3H3,(H2,25,28)/t22-/m0/s1 |
| InChIKey | DHYHNZGNWLSWMO-QFIPXVFZSA-N |
| XLogP | 3.96 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |